C15H19O3P — CID 59125897
6-methoxy-7-phosphanyloxy-3,4,4a,9,10,10a-hexahydro-2H-phenanthren-1-one (PubChem CID 59125897) has the molecular formula C15H19O3P and a molecular weight of 278.29 g/mol. Its IUPAC name is 6-methoxy-7-phosphanyloxy-3,4,4a,9,10,10a-hexahydro-2H-phenanthren-1-one.
| Compound Name | 6-methoxy-7-phosphanyloxy-3,4,4a,9,10,10a-hexahydro-2H-phenanthren-1-one |
|---|---|
| PubChem CID | 59125897 |
| Molecular Formula | C15H19O3P |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 6-methoxy-7-phosphanyloxy-3,4,4a,9,10,10a-hexahydro-2H-phenanthren-1-one |
| SMILES | COc1cc2c(cc1OP)CCC1C(=O)CCCC21 |
| InChI | InChI=1S/C15H19O3P/c1-17-14-8-12-9(7-15(14)18-19)5-6-11-10(12)3-2-4-13(11)16/h7-8,10-11H,2-6,19H2,1H3 |
| InChIKey | AVXUUBKJDVGDQO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|