C21H27NO4 — CID 62706576
(1S,2R)-2-(3,4-dimethoxyphenyl)-6,7-dimethoxy-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 62706576) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is (1S,2R)-2-(3,4-dimethoxyphenyl)-6,7-dimethoxy-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1S,2R)-2-(3,4-dimethoxyphenyl)-6,7-dimethoxy-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 62706576 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (1S,2R)-2-(3,4-dimethoxyphenyl)-6,7-dimethoxy-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CN[C@@H]1c2cc(OC)c(OC)cc2CC[C@@H]1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H27NO4/c1-22-21-15(13-7-9-17(23-2)18(10-13)24-3)8-6-14-11-19(25-4)20(26-5)12-16(14)21/h7,9-12,15,21-22H,6,8H2,1-5H3/t15-,21+/m1/s1 |
| InChIKey | CKCXZCRSAZAETE-VFNWGFHPSA-N |
| XLogP | 3.71 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |