C27H32ClNO4 — CID 62707044
(1S,2R)-2-(3,4-dimethoxyphenyl)-7-methoxy-N-methyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (PubChem CID 62707044) has the molecular formula C27H32ClNO4 and a molecular weight of 470.01 g/mol. Its IUPAC name is (1S,2R)-2-(3,4-dimethoxyphenyl)-7-methoxy-N-methyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride.
| Compound Name | (1S,2R)-2-(3,4-dimethoxyphenyl)-7-methoxy-N-methyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
|---|---|
| PubChem CID | 62707044 |
| Molecular Formula | C27H32ClNO4 |
| Molecular Weight | 470.01 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | (1S,2R)-2-(3,4-dimethoxyphenyl)-7-methoxy-N-methyl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| SMILES | CN[C@@H]1c2cc(OC)c(OCc3ccccc3)cc2CC[C@@H]1c1ccc(OC)c(OC)c1.Cl |
| InChI | InChI=1S/C27H31NO4.ClH/c1-28-27-21(19-11-13-23(29-2)24(14-19)30-3)12-10-20-15-26(25(31-4)16-22(20)27)32-17-18-8-6-5-7-9-18;/h5-9,11,13-16,21,27-28H,10,12,17H2,1-4H3;1H/t21-,27+;/m1./s1 |
| InChIKey | FXQCGPKNSBHKRO-HXEWSPMQSA-N |
| XLogP | 5.70 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.01 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |