C20H12F3N5O3 — CID 59135428
N-(7-pyridin-4-yloxy-1,2,4-benzotriazin-3-yl)-4-(trifluoromethoxy)benzamide (PubChem CID 59135428) has the molecular formula C20H12F3N5O3 and a molecular weight of 427.34 g/mol. Its IUPAC name is N-(7-pyridin-4-yloxy-1,2,4-benzotriazin-3-yl)-4-(trifluoromethoxy)benzamide.
| Compound Name | N-(7-pyridin-4-yloxy-1,2,4-benzotriazin-3-yl)-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 59135428 |
| Molecular Formula | C20H12F3N5O3 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | N-(7-pyridin-4-yloxy-1,2,4-benzotriazin-3-yl)-4-(trifluoromethoxy)benzamide |
| SMILES | O=C(Nc1nnc2cc(Oc3ccncc3)ccc2n1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H12F3N5O3/c21-20(22,23)31-14-3-1-12(2-4-14)18(29)26-19-25-16-6-5-15(11-17(16)27-28-19)30-13-7-9-24-10-8-13/h1-11H,(H,25,26,28,29) |
| InChIKey | AZDUKTNUTISXOZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |