C24H18N4O6S2 — CID 59136487
2-amino-3-oxo-1-N,9-N-diphenylphenoxazine-1,9-disulfonamide (PubChem CID 59136487) has the molecular formula C24H18N4O6S2 and a molecular weight of 522.56 g/mol. Its IUPAC name is 2-amino-3-oxo-1-N,9-N-diphenylphenoxazine-1,9-disulfonamide.
| Compound Name | 2-amino-3-oxo-1-N,9-N-diphenylphenoxazine-1,9-disulfonamide |
|---|---|
| PubChem CID | 59136487 |
| Molecular Formula | C24H18N4O6S2 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 2-amino-3-oxo-1-N,9-N-diphenylphenoxazine-1,9-disulfonamide |
| SMILES | Nc1c(S(=O)(=O)Nc2ccccc2)c2nc3c(S(=O)(=O)Nc4ccccc4)cccc3oc-2cc1=O |
| InChI | InChI=1S/C24H18N4O6S2/c25-21-17(29)14-19-23(24(21)36(32,33)28-16-10-5-2-6-11-16)26-22-18(34-19)12-7-13-20(22)35(30,31)27-15-8-3-1-4-9-15/h1-14,27-28H,25H2 |
| InChIKey | YLHCBKWEFHDXDA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 161.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|