About 2-amino-3-oxo-1-N,9-N-diphenylphenoxazine-1,9-disulfonamide
2-amino-3-oxo-1-N,9-N-diphenylphenoxazine-1,9-disulfonamide (PubChem CID 59136487) has the molecular formula C24H18N4O6S2
and a molecular weight of 522.56 g/mol. Its IUPAC name is 2-amino-3-oxo-1-N,9-N-diphenylphenoxazine-1,9-disulfonamide.
Molecular Properties
| Compound Name | 2-amino-3-oxo-1-N,9-N-diphenylphenoxazine-1,9-disulfonamide |
| PubChem CID | 59136487 |
| Molecular Formula | C24H18N4O6S2 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 2-amino-3-oxo-1-N,9-N-diphenylphenoxazine-1,9-disulfonamide |
| SMILES | Nc1c(S(=O)(=O)Nc2ccccc2)c2nc3c(S(=O)(=O)Nc4ccccc4)cccc3oc-2cc1=O |
| InChI | InChI=1S/C24H18N4O6S2/c25-21-17(29)14-19-23(24(21)36(32,33)28-16-10-5-2-6-11-16)26-22-18(34-19)12-7-13-20(22)35(30,31)27-15-8-3-1-4-9-15/h1-14,27-28H,25H2 |
| InChIKey | YLHCBKWEFHDXDA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 161.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-oxo-1-N,9-N-diphenylphenoxazine-1,9-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-oxo-1-N,9-N-diphenylphenoxazine-1,9-disulfonamide?
The IUPAC name of 2-amino-3-oxo-1-N,9-N-diphenylphenoxazine-1,9-disulfonamide (CID 59136487) is 2-amino-3-oxo-1-N,9-N-diphenylphenoxazine-1,9-disulfonamide.
What is the SMILES notation for 2-amino-3-oxo-1-N,9-N-diphenylphenoxazine-1,9-disulfonamide?
The canonical SMILES for 2-amino-3-oxo-1-N,9-N-diphenylphenoxazine-1,9-disulfonamide is Nc1c(S(=O)(=O)Nc2ccccc2)c2nc3c(S(=O)(=O)Nc4ccccc4)cccc3oc-2cc1=O.
What is the InChIKey of 2-amino-3-oxo-1-N,9-N-diphenylphenoxazine-1,9-disulfonamide?
The InChIKey is YLHCBKWEFHDXDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18N4O6S2/c25-21-17(29)14-19-23(24(21)36(32,33)28-16-10-5-2-6-11-16)26-22-18(34-19)12-7-13-20(22)35(30,31)27-15-8-3-1-4-9-15/h1-14,27-28H,25H2.
What are the key properties of 2-amino-3-oxo-1-N,9-N-diphenylphenoxazine-1,9-disulfonamide?
2-amino-3-oxo-1-N,9-N-diphenylphenoxazine-1,9-disulfonamide has a molecular weight of 522.56 g/mol, XLogP of 3.48, 6 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-oxo-1-N,9-N-diphenylphenoxazine-1,9-disulfonamide is sourced from PubChem (CID 59136487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).