C15H26N4O2 — CID 59137325
2-methylpropyl N-[(2R)-1-[(4-propan-2-ylpyrimidin-2-yl)amino]propan-2-yl]carbamate (PubChem CID 59137325) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-methylpropyl N-[(2R)-1-[(4-propan-2-ylpyrimidin-2-yl)amino]propan-2-yl]carbamate.
| Compound Name | 2-methylpropyl N-[(2R)-1-[(4-propan-2-ylpyrimidin-2-yl)amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 59137325 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 2-methylpropyl N-[(2R)-1-[(4-propan-2-ylpyrimidin-2-yl)amino]propan-2-yl]carbamate |
| SMILES | CC(C)COC(=O)N[C@H](C)CNc1nccc(C(C)C)n1 |
| InChI | InChI=1S/C15H26N4O2/c1-10(2)9-21-15(20)18-12(5)8-17-14-16-7-6-13(19-14)11(3)4/h6-7,10-12H,8-9H2,1-5H3,(H,18,20)(H,16,17,19)/t12-/m1/s1 |
| InChIKey | FIYQOONFZDNGAC-GFCCVEGCSA-N |
| XLogP | 2.78 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |