About 2,2-dimethylpropyl N-[(2R)-1-[(4-propan-2-ylpyrimidin-2-yl)amino]propan-2-yl]carbamate
2,2-dimethylpropyl N-[(2R)-1-[(4-propan-2-ylpyrimidin-2-yl)amino]propan-2-yl]carbamate (PubChem CID 59137359) has the molecular formula C16H28N4O2
and a molecular weight of 308.43 g/mol. Its IUPAC name is 2,2-dimethylpropyl N-[(2R)-1-[(4-propan-2-ylpyrimidin-2-yl)amino]propan-2-yl]carbamate.
Molecular Properties
| Compound Name | 2,2-dimethylpropyl N-[(2R)-1-[(4-propan-2-ylpyrimidin-2-yl)amino]propan-2-yl]carbamate |
| PubChem CID | 59137359 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 2,2-dimethylpropyl N-[(2R)-1-[(4-propan-2-ylpyrimidin-2-yl)amino]propan-2-yl]carbamate |
| SMILES | CC(C)c1ccnc(NC[C@@H](C)NC(=O)OCC(C)(C)C)n1 |
| InChI | InChI=1S/C16H28N4O2/c1-11(2)13-7-8-17-14(20-13)18-9-12(3)19-15(21)22-10-16(4,5)6/h7-8,11-12H,9-10H2,1-6H3,(H,19,21)(H,17,18,20)/t12-/m1/s1 |
| InChIKey | ZWGDYZSGQDZJOR-GFCCVEGCSA-N |
| XLogP | 3.17 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,2-dimethylpropyl N-[(2R)-1-[(4-propan-2-ylpyrimidin-2-yl)amino]propan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropyl N-[(2R)-1-[(4-propan-2-ylpyrimidin-2-yl)amino]propan-2-yl]carbamate?
The IUPAC name of 2,2-dimethylpropyl N-[(2R)-1-[(4-propan-2-ylpyrimidin-2-yl)amino]propan-2-yl]carbamate (CID 59137359) is 2,2-dimethylpropyl N-[(2R)-1-[(4-propan-2-ylpyrimidin-2-yl)amino]propan-2-yl]carbamate.
What is the SMILES notation for 2,2-dimethylpropyl N-[(2R)-1-[(4-propan-2-ylpyrimidin-2-yl)amino]propan-2-yl]carbamate?
The canonical SMILES for 2,2-dimethylpropyl N-[(2R)-1-[(4-propan-2-ylpyrimidin-2-yl)amino]propan-2-yl]carbamate is CC(C)c1ccnc(NC[C@@H](C)NC(=O)OCC(C)(C)C)n1.
What is the InChIKey of 2,2-dimethylpropyl N-[(2R)-1-[(4-propan-2-ylpyrimidin-2-yl)amino]propan-2-yl]carbamate?
The InChIKey is ZWGDYZSGQDZJOR-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H28N4O2/c1-11(2)13-7-8-17-14(20-13)18-9-12(3)19-15(21)22-10-16(4,5)6/h7-8,11-12H,9-10H2,1-6H3,(H,19,21)(H,17,18,20)/t12-/m1/s1.
What are the key properties of 2,2-dimethylpropyl N-[(2R)-1-[(4-propan-2-ylpyrimidin-2-yl)amino]propan-2-yl]carbamate?
2,2-dimethylpropyl N-[(2R)-1-[(4-propan-2-ylpyrimidin-2-yl)amino]propan-2-yl]carbamate has a molecular weight of 308.43 g/mol, XLogP of 3.17, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropyl N-[(2R)-1-[(4-propan-2-ylpyrimidin-2-yl)amino]propan-2-yl]carbamate is sourced from PubChem (CID 59137359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).