C33H60N4O13S2 — CID 59137646
3-[3-[2-[2-[2-[2-[[6-amino-2-[3-[2-[2-[2-(4-oxopentoxy)ethoxy]ethoxy]ethoxy]propanoylamino]hexanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl]dithiirane-3-carboxamide (PubChem CID 59137646) has the molecular formula C33H60N4O13S2 and a molecular weight of 784.99 g/mol. Its IUPAC name is 3-[3-[2-[2-[2-[2-[[6-amino-2-[3-[2-[2-[2-(4-oxopentoxy)ethoxy]ethoxy]ethoxy]propanoylamino]hexanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl]dithiirane-3-carboxamide.
| Compound Name | 3-[3-[2-[2-[2-[2-[[6-amino-2-[3-[2-[2-[2-(4-oxopentoxy)ethoxy]ethoxy]ethoxy]propanoylamino]hexanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl]dithiirane-3-carboxamide |
|---|---|
| PubChem CID | 59137646 |
| Molecular Formula | C33H60N4O13S2 |
| Molecular Weight | 784.99 g/mol |
| Exact Mass | 784.36 |
| IUPAC Name | 3-[3-[2-[2-[2-[2-[[6-amino-2-[3-[2-[2-[2-(4-oxopentoxy)ethoxy]ethoxy]ethoxy]propanoylamino]hexanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl]dithiirane-3-carboxamide |
| SMILES | CC(=O)CCCOCCOCCOCCOCCC(=O)NC(CCCCN)C(=O)NCCOCCOCCOCCOCCC(=O)C1(C(N)=O)SS1 |
| InChI | InChI=1S/C33H60N4O13S2/c1-27(38)5-4-11-43-15-19-47-23-24-49-21-17-45-13-8-30(40)37-28(6-2-3-9-34)31(41)36-10-14-46-18-22-50-26-25-48-20-16-44-12-7-29(39)33(32(35)42)51-52-33/h28H,2-26,34H2,1H3,(H2,35,42)(H,36,41)(H,37,40) |
| InChIKey | OCWAYOMEOPSFNK-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 235.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.99 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|