C29H55N5O8 — CID 170747971
(2S)-N-(1-acetamido-8,8-dimethyl-6-oxononan-5-yl)-6-amino-2-[3-[2-[2-(2-formamidoethoxy)ethoxy]ethoxy]propanoylamino]hexanamide (PubChem CID 170747971) has the molecular formula C29H55N5O8 and a molecular weight of 601.79 g/mol. Its IUPAC name is (2S)-N-(1-acetamido-8,8-dimethyl-6-oxononan-5-yl)-6-amino-2-[3-[2-[2-(2-formamidoethoxy)ethoxy]ethoxy]propanoylamino]hexanamide.
| Compound Name | (2S)-N-(1-acetamido-8,8-dimethyl-6-oxononan-5-yl)-6-amino-2-[3-[2-[2-(2-formamidoethoxy)ethoxy]ethoxy]propanoylamino]hexanamide |
|---|---|
| PubChem CID | 170747971 |
| Molecular Formula | C29H55N5O8 |
| Molecular Weight | 601.79 g/mol |
| Exact Mass | 601.41 |
| IUPAC Name | (2S)-N-(1-acetamido-8,8-dimethyl-6-oxononan-5-yl)-6-amino-2-[3-[2-[2-(2-formamidoethoxy)ethoxy]ethoxy]propanoylamino]hexanamide |
| SMILES | CC(=O)NCCCCC(NC(=O)[C@H](CCCCN)NC(=O)CCOCCOCCOCCNC=O)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C29H55N5O8/c1-23(36)32-13-8-6-9-24(26(37)21-29(2,3)4)34-28(39)25(10-5-7-12-30)33-27(38)11-15-40-17-19-42-20-18-41-16-14-31-22-35/h22,24-25H,5-21,30H2,1-4H3,(H,31,35)(H,32,36)(H,33,38)(H,34,39)/t24?,25-/m0/s1 |
| InChIKey | ZDMGPWWCZLQFNX-BBMPLOMVSA-N |
| XLogP | 0.58 |
| TPSA | 187.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.79 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|