C21H23FN4O2 — CID 59139735
5-[2-(ethylamino)ethyl]-2-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-6,7-dihydro-1H-pyrrolo[3,2-c]pyridin-4-one (PubChem CID 59139735) has the molecular formula C21H23FN4O2 and a molecular weight of 382.44 g/mol. Its IUPAC name is 5-[2-(ethylamino)ethyl]-2-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-6,7-dihydro-1H-pyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 5-[2-(ethylamino)ethyl]-2-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-6,7-dihydro-1H-pyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 59139735 |
| Molecular Formula | C21H23FN4O2 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 5-[2-(ethylamino)ethyl]-2-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-6,7-dihydro-1H-pyrrolo[3,2-c]pyridin-4-one |
| SMILES | CCNCCN1CCc2[nH]c(/C=C3\C(=O)Nc4ccc(F)cc43)c(C)c2C1=O |
| InChI | InChI=1S/C21H23FN4O2/c1-3-23-7-9-26-8-6-17-19(21(26)28)12(2)18(24-17)11-15-14-10-13(22)4-5-16(14)25-20(15)27/h4-5,10-11,23-24H,3,6-9H2,1-2H3,(H,25,27)/b15-11- |
| InChIKey | YTUMZRDKADJBSW-PTNGSMBKSA-N |
| XLogP | 2.56 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|