C23H28N4O3 — CID 70917183
5-[2-(ethylamino)ethyl]-2-[(Z)-(6-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-1,6,7,8-tetrahydropyrrolo[3,2-c]azepin-4-one (PubChem CID 70917183) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 5-[2-(ethylamino)ethyl]-2-[(Z)-(6-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-1,6,7,8-tetrahydropyrrolo[3,2-c]azepin-4-one.
| Compound Name | 5-[2-(ethylamino)ethyl]-2-[(Z)-(6-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-1,6,7,8-tetrahydropyrrolo[3,2-c]azepin-4-one |
|---|---|
| PubChem CID | 70917183 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 5-[2-(ethylamino)ethyl]-2-[(Z)-(6-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-1,6,7,8-tetrahydropyrrolo[3,2-c]azepin-4-one |
| SMILES | CCNCCN1CCCc2[nH]c(/C=C3\C(=O)Nc4cc(OC)ccc43)c(C)c2C1=O |
| InChI | InChI=1S/C23H28N4O3/c1-4-24-9-11-27-10-5-6-18-21(23(27)29)14(2)19(25-18)13-17-16-8-7-15(30-3)12-20(16)26-22(17)28/h7-8,12-13,24-25H,4-6,9-11H2,1-3H3,(H,26,28)/b17-13- |
| InChIKey | DYOLQVPXBNYDPA-LGMDPLHJSA-N |
| XLogP | 2.82 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|