C20H34N4O3 — CID 59141396
N-[[3,5-bis(acetamidomethyl)-7-(aminomethyl)-1-adamantyl]methyl]acetamide (PubChem CID 59141396) has the molecular formula C20H34N4O3 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[[3,5-bis(acetamidomethyl)-7-(aminomethyl)-1-adamantyl]methyl]acetamide.
| Compound Name | N-[[3,5-bis(acetamidomethyl)-7-(aminomethyl)-1-adamantyl]methyl]acetamide |
|---|---|
| PubChem CID | 59141396 |
| Molecular Formula | C20H34N4O3 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | N-[[3,5-bis(acetamidomethyl)-7-(aminomethyl)-1-adamantyl]methyl]acetamide |
| SMILES | CC(=O)NCC12CC3(CN)CC(CNC(C)=O)(C1)CC(CNC(C)=O)(C3)C2 |
| InChI | InChI=1S/C20H34N4O3/c1-14(25)22-11-18-4-17(10-21)5-19(7-18,12-23-15(2)26)9-20(6-17,8-18)13-24-16(3)27/h4-13,21H2,1-3H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | FFHRHELHWTWKML-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |