C7H13NO3 — CID 59142304
tert-butyl N-(1,1,2-trideuterio-2-oxoethyl)carbamate (PubChem CID 59142304) has the molecular formula C7H13NO3 and a molecular weight of 162.20 g/mol. Its IUPAC name is tert-butyl N-(1,1,2-trideuterio-2-oxoethyl)carbamate.
| Compound Name | tert-butyl N-(1,1,2-trideuterio-2-oxoethyl)carbamate |
|---|---|
| PubChem CID | 59142304 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.11 |
| IUPAC Name | tert-butyl N-(1,1,2-trideuterio-2-oxoethyl)carbamate |
| SMILES | [2H]C(=O)C([2H])([2H])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C7H13NO3/c1-7(2,3)11-6(10)8-4-5-9/h5H,4H2,1-3H3,(H,8,10)/i4D2,5D |
| InChIKey | ACNRTYKOPZDRCO-AFBAWBIXSA-N |
| XLogP | 0.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|