C23H31N3O6 — CID 59142696
benzyl N-[3-[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]cycloheptyl]propyl]carbamate (PubChem CID 59142696) has the molecular formula C23H31N3O6 and a molecular weight of 445.52 g/mol. Its IUPAC name is benzyl N-[3-[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]cycloheptyl]propyl]carbamate.
| Compound Name | benzyl N-[3-[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]cycloheptyl]propyl]carbamate |
|---|---|
| PubChem CID | 59142696 |
| Molecular Formula | C23H31N3O6 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | benzyl N-[3-[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]cycloheptyl]propyl]carbamate |
| SMILES | O=C(NCCCC1CCCC(NC(=O)ON2C(=O)CCC2=O)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C23H31N3O6/c27-20-13-14-21(28)26(20)32-23(30)25-19-10-4-8-17(11-12-19)9-5-15-24-22(29)31-16-18-6-2-1-3-7-18/h1-3,6-7,17,19H,4-5,8-16H2,(H,24,29)(H,25,30) |
| InChIKey | IMXNEHBCRPZVBN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|