About benzyl N-[3-[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]cycloheptyl]propyl]carbamate
benzyl N-[3-[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]cycloheptyl]propyl]carbamate (PubChem CID 59142696) has the molecular formula C23H31N3O6
and a molecular weight of 445.52 g/mol. Its IUPAC name is benzyl N-[3-[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]cycloheptyl]propyl]carbamate.
Molecular Properties
| Compound Name | benzyl N-[3-[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]cycloheptyl]propyl]carbamate |
| PubChem CID | 59142696 |
| Molecular Formula | C23H31N3O6 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | benzyl N-[3-[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]cycloheptyl]propyl]carbamate |
| SMILES | O=C(NCCCC1CCCC(NC(=O)ON2C(=O)CCC2=O)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C23H31N3O6/c27-20-13-14-21(28)26(20)32-23(30)25-19-10-4-8-17(11-12-19)9-5-15-24-22(29)31-16-18-6-2-1-3-7-18/h1-3,6-7,17,19H,4-5,8-16H2,(H,24,29)(H,25,30) |
| InChIKey | IMXNEHBCRPZVBN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-[3-[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]cycloheptyl]propyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[3-[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]cycloheptyl]propyl]carbamate?
The IUPAC name of benzyl N-[3-[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]cycloheptyl]propyl]carbamate (CID 59142696) is benzyl N-[3-[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]cycloheptyl]propyl]carbamate.
What is the SMILES notation for benzyl N-[3-[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]cycloheptyl]propyl]carbamate?
The canonical SMILES for benzyl N-[3-[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]cycloheptyl]propyl]carbamate is O=C(NCCCC1CCCC(NC(=O)ON2C(=O)CCC2=O)CC1)OCc1ccccc1.
What is the InChIKey of benzyl N-[3-[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]cycloheptyl]propyl]carbamate?
The InChIKey is IMXNEHBCRPZVBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31N3O6/c27-20-13-14-21(28)26(20)32-23(30)25-19-10-4-8-17(11-12-19)9-5-15-24-22(29)31-16-18-6-2-1-3-7-18/h1-3,6-7,17,19H,4-5,8-16H2,(H,24,29)(H,25,30).
What are the key properties of benzyl N-[3-[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]cycloheptyl]propyl]carbamate?
benzyl N-[3-[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]cycloheptyl]propyl]carbamate has a molecular weight of 445.52 g/mol, XLogP of 3.43, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[3-[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]cycloheptyl]propyl]carbamate is sourced from PubChem (CID 59142696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).