C18H22N4O7 — CID 101377988
(2,5-dioxopyrrolidin-1-yl) 3-[nitroso-[3-(phenylmethoxycarbonylamino)propyl]amino]propanoate (PubChem CID 101377988) has the molecular formula C18H22N4O7 and a molecular weight of 406.40 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[nitroso-[3-(phenylmethoxycarbonylamino)propyl]amino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[nitroso-[3-(phenylmethoxycarbonylamino)propyl]amino]propanoate |
|---|---|
| PubChem CID | 101377988 |
| Molecular Formula | C18H22N4O7 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[nitroso-[3-(phenylmethoxycarbonylamino)propyl]amino]propanoate |
| SMILES | O=NN(CCCNC(=O)OCc1ccccc1)CCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C18H22N4O7/c23-15-7-8-16(24)22(15)29-17(25)9-12-21(20-27)11-4-10-19-18(26)28-13-14-5-2-1-3-6-14/h1-3,5-6H,4,7-13H2,(H,19,26) |
| InChIKey | CHZIPJWDYKROJG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|