C28H30N2O4 — CID 59142833
21-cyclohexyl-9-methyl-9,14-diazapentacyclo[12.7.0.02,7.08,12.015,20]henicosa-1(21),2,4,6,15(20),16,18-heptaene-10,17-dicarboxylic acid (PubChem CID 59142833) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is 21-cyclohexyl-9-methyl-9,14-diazapentacyclo[12.7.0.02,7.08,12.015,20]henicosa-1(21),2,4,6,15(20),16,18-heptaene-10,17-dicarboxylic acid.
| Compound Name | 21-cyclohexyl-9-methyl-9,14-diazapentacyclo[12.7.0.02,7.08,12.015,20]henicosa-1(21),2,4,6,15(20),16,18-heptaene-10,17-dicarboxylic acid |
|---|---|
| PubChem CID | 59142833 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 21-cyclohexyl-9-methyl-9,14-diazapentacyclo[12.7.0.02,7.08,12.015,20]henicosa-1(21),2,4,6,15(20),16,18-heptaene-10,17-dicarboxylic acid |
| SMILES | CN1C(C(=O)O)CC2Cn3c(c(C4CCCCC4)c4ccc(C(=O)O)cc43)-c3ccccc3C21 |
| InChI | InChI=1S/C28H30N2O4/c1-29-23(28(33)34)14-18-15-30-22-13-17(27(31)32)11-12-21(22)24(16-7-3-2-4-8-16)26(30)20-10-6-5-9-19(20)25(18)29/h5-6,9-13,16,18,23,25H,2-4,7-8,14-15H2,1H3,(H,31,32)(H,33,34) |
| InChIKey | PQXOXESLJOAOOO-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |