C12H22O2 — CID 59143670
5-ethoxy-2,7-dimethyloct-7-en-4-one (PubChem CID 59143670) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 5-ethoxy-2,7-dimethyloct-7-en-4-one.
| Compound Name | 5-ethoxy-2,7-dimethyloct-7-en-4-one |
|---|---|
| PubChem CID | 59143670 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 5-ethoxy-2,7-dimethyloct-7-en-4-one |
| SMILES | C=C(C)CC(OCC)C(=O)CC(C)C |
| InChI | InChI=1S/C12H22O2/c1-6-14-12(8-10(4)5)11(13)7-9(2)3/h9,12H,4,6-8H2,1-3,5H3 |
| InChIKey | VRJLNBHAMCGSNB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|