C23H24N4O4 — CID 59144478
6-amino-1'-(7-methoxy-3-methyl-1H-indole-2-carbonyl)spiro[3H-1,3-benzoxazine-2,4'-piperidine]-4-one (PubChem CID 59144478) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is 6-amino-1'-(7-methoxy-3-methyl-1H-indole-2-carbonyl)spiro[3H-1,3-benzoxazine-2,4'-piperidine]-4-one.
| Compound Name | 6-amino-1'-(7-methoxy-3-methyl-1H-indole-2-carbonyl)spiro[3H-1,3-benzoxazine-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 59144478 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 6-amino-1'-(7-methoxy-3-methyl-1H-indole-2-carbonyl)spiro[3H-1,3-benzoxazine-2,4'-piperidine]-4-one |
| SMILES | COc1cccc2c(C)c(C(=O)N3CCC4(CC3)NC(=O)c3cc(N)ccc3O4)[nH]c12 |
| InChI | InChI=1S/C23H24N4O4/c1-13-15-4-3-5-18(30-2)20(15)25-19(13)22(29)27-10-8-23(9-11-27)26-21(28)16-12-14(24)6-7-17(16)31-23/h3-7,12,25H,8-11,24H2,1-2H3,(H,26,28) |
| InChIKey | CHBJMEKYCRQNRZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|