C22H24N4O3 — CID 91373216
1'-(4-amino-3-methanimidoyl-5-methylbenzoyl)-6-methylspiro[3H-1,3-benzoxazine-2,4'-piperidine]-4-one (PubChem CID 91373216) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 1'-(4-amino-3-methanimidoyl-5-methylbenzoyl)-6-methylspiro[3H-1,3-benzoxazine-2,4'-piperidine]-4-one.
| Compound Name | 1'-(4-amino-3-methanimidoyl-5-methylbenzoyl)-6-methylspiro[3H-1,3-benzoxazine-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 91373216 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1'-(4-amino-3-methanimidoyl-5-methylbenzoyl)-6-methylspiro[3H-1,3-benzoxazine-2,4'-piperidine]-4-one |
| SMILES | [H]/N=C/c1cc(C(=O)N2CCC3(CC2)NC(=O)c2cc(C)ccc2O3)cc(C)c1N |
| InChI | InChI=1S/C22H24N4O3/c1-13-3-4-18-17(9-13)20(27)25-22(29-18)5-7-26(8-6-22)21(28)15-10-14(2)19(24)16(11-15)12-23/h3-4,9-12,23H,5-8,24H2,1-2H3,(H,25,27)/b23-12+ |
| InChIKey | YDLOFTXXJOBBQM-FSJBWODESA-N |
| XLogP | 2.64 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|