C17H18F3N3O6 — CID 59149053
[(2R,5R)-5-[2,4-dioxo-5-[3-(trifluoromethoxymethylideneamino)prop-1-ynyl]pyrimidin-1-yl]-2-ethyloxolan-3-yl] acetate (PubChem CID 59149053) has the molecular formula C17H18F3N3O6 and a molecular weight of 417.34 g/mol. Its IUPAC name is [(2R,5R)-5-[2,4-dioxo-5-[3-(trifluoromethoxymethylideneamino)prop-1-ynyl]pyrimidin-1-yl]-2-ethyloxolan-3-yl] acetate.
| Compound Name | [(2R,5R)-5-[2,4-dioxo-5-[3-(trifluoromethoxymethylideneamino)prop-1-ynyl]pyrimidin-1-yl]-2-ethyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 59149053 |
| Molecular Formula | C17H18F3N3O6 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | [(2R,5R)-5-[2,4-dioxo-5-[3-(trifluoromethoxymethylideneamino)prop-1-ynyl]pyrimidin-1-yl]-2-ethyloxolan-3-yl] acetate |
| SMILES | CC[C@H]1O[C@@H](n2cc(C#CC/N=C/OC(F)(F)F)c(=O)[nH]c2=O)CC1OC(C)=O |
| InChI | InChI=1S/C17H18F3N3O6/c1-3-12-13(28-10(2)24)7-14(29-12)23-8-11(15(25)22-16(23)26)5-4-6-21-9-27-17(18,19)20/h8-9,12-14H,3,6-7H2,1-2H3,(H,22,25,26)/b21-9+/t12-,13?,14-/m1/s1 |
| InChIKey | HDXZYBHZZBRYFF-WPANLNBMSA-N |
| XLogP | 1.08 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|