C23H23ClFN5O2 — CID 59151106
N-(3-chlorophenyl)-4-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)methyliminomethyl]-3-methoxyaniline (PubChem CID 59151106) has the molecular formula C23H23ClFN5O2 and a molecular weight of 455.92 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)methyliminomethyl]-3-methoxyaniline.
| Compound Name | N-(3-chlorophenyl)-4-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)methyliminomethyl]-3-methoxyaniline |
|---|---|
| PubChem CID | 59151106 |
| Molecular Formula | C23H23ClFN5O2 |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-(3-chlorophenyl)-4-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)methyliminomethyl]-3-methoxyaniline |
| SMILES | COc1cc(Nc2cccc(Cl)c2)ccc1/C=N/Cc1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C23H23ClFN5O2/c1-31-21-12-19(28-18-4-2-3-17(24)11-18)6-5-16(21)13-26-15-22-27-14-20(25)23(29-22)30-7-9-32-10-8-30/h2-6,11-14,28H,7-10,15H2,1H3/b26-13+ |
| InChIKey | SAORXVNANMRUEL-LGJNPRDNSA-N |
| XLogP | 4.48 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|