C18H23N3O3 — CID 59151474
[1-(tert-butylamino)-1-oxopropan-2-yl] 3-(4-methylphenyl)-1H-pyrazole-5-carboxylate (PubChem CID 59151474) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is [1-(tert-butylamino)-1-oxopropan-2-yl] 3-(4-methylphenyl)-1H-pyrazole-5-carboxylate.
| Compound Name | [1-(tert-butylamino)-1-oxopropan-2-yl] 3-(4-methylphenyl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 59151474 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | [1-(tert-butylamino)-1-oxopropan-2-yl] 3-(4-methylphenyl)-1H-pyrazole-5-carboxylate |
| SMILES | Cc1ccc(-c2cc(C(=O)OC(C)C(=O)NC(C)(C)C)[nH]n2)cc1 |
| InChI | InChI=1S/C18H23N3O3/c1-11-6-8-13(9-7-11)14-10-15(21-20-14)17(23)24-12(2)16(22)19-18(3,4)5/h6-10,12H,1-5H3,(H,19,22)(H,20,21) |
| InChIKey | CQHGGMGWVUCJGI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |