C14H10Cl2N4O — CID 59151545
5-chloro-1-[(2-chloro-5-cyanophenyl)methyl]-2-iminopyridine-3-carboxamide (PubChem CID 59151545) has the molecular formula C14H10Cl2N4O and a molecular weight of 321.17 g/mol. Its IUPAC name is 5-chloro-1-[(2-chloro-5-cyanophenyl)methyl]-2-iminopyridine-3-carboxamide.
| Compound Name | 5-chloro-1-[(2-chloro-5-cyanophenyl)methyl]-2-iminopyridine-3-carboxamide |
|---|---|
| PubChem CID | 59151545 |
| Molecular Formula | C14H10Cl2N4O |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 5-chloro-1-[(2-chloro-5-cyanophenyl)methyl]-2-iminopyridine-3-carboxamide |
| SMILES | [H]/N=c1/c(C(N)=O)cc(Cl)cn1Cc1cc(C#N)ccc1Cl |
| InChI | InChI=1S/C14H10Cl2N4O/c15-10-4-11(14(19)21)13(18)20(7-10)6-9-3-8(5-17)1-2-12(9)16/h1-4,7,18H,6H2,(H2,19,21)/b18-13- |
| InChIKey | PSKNGJIMJPFPFH-AQTBWJFISA-N |
| XLogP | 2.29 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |