C18H23NO3 — CID 59151694
(3-tert-butyl-7-oxo-8H-quinolin-5-yl) 2,2-dimethylpropanoate (PubChem CID 59151694) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is (3-tert-butyl-7-oxo-8H-quinolin-5-yl) 2,2-dimethylpropanoate.
| Compound Name | (3-tert-butyl-7-oxo-8H-quinolin-5-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59151694 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | (3-tert-butyl-7-oxo-8H-quinolin-5-yl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC1=CC(=O)Cc2ncc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C18H23NO3/c1-17(2,3)11-7-13-14(19-10-11)8-12(20)9-15(13)22-16(21)18(4,5)6/h7,9-10H,8H2,1-6H3 |
| InChIKey | IUKXLUXBLSIULA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |