C17H24O5 — CID 159024647
cyclohexane-1,3-dione;(3-oxocyclohexen-1-yl) 2,2-dimethylpropanoate (PubChem CID 159024647) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is cyclohexane-1,3-dione;(3-oxocyclohexen-1-yl) 2,2-dimethylpropanoate.
| Compound Name | cyclohexane-1,3-dione;(3-oxocyclohexen-1-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 159024647 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | cyclohexane-1,3-dione;(3-oxocyclohexen-1-yl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC1=CC(=O)CCC1.O=C1CCCC(=O)C1 |
| InChI | InChI=1S/C11H16O3.C6H8O2/c1-11(2,3)10(13)14-9-6-4-5-8(12)7-9;7-5-2-1-3-6(8)4-5/h7H,4-6H2,1-3H3;1-4H2 |
| InChIKey | JUDBQVJDQOLEGN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|