C15H18O2 — CID 102590647
3,4-dihydronaphthalen-2-yl 2,2-dimethylpropanoate (PubChem CID 102590647) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 3,4-dihydronaphthalen-2-yl 2,2-dimethylpropanoate.
| Compound Name | 3,4-dihydronaphthalen-2-yl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102590647 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 3,4-dihydronaphthalen-2-yl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC1=Cc2ccccc2CC1 |
| InChI | InChI=1S/C15H18O2/c1-15(2,3)14(16)17-13-9-8-11-6-4-5-7-12(11)10-13/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | TYLOCIDMZGIHDP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |