C24H22O4 — CID 95931126
(2-methyl-6,11-dioxo-3,4-dihydrotetracen-5-yl) 2,2-dimethylpropanoate (PubChem CID 95931126) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is (2-methyl-6,11-dioxo-3,4-dihydrotetracen-5-yl) 2,2-dimethylpropanoate.
| Compound Name | (2-methyl-6,11-dioxo-3,4-dihydrotetracen-5-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 95931126 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (2-methyl-6,11-dioxo-3,4-dihydrotetracen-5-yl) 2,2-dimethylpropanoate |
| SMILES | CC1=Cc2cc3c(c(OC(=O)C(C)(C)C)c2CC1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C24H22O4/c1-13-9-10-15-14(11-13)12-18-19(22(15)28-23(27)24(2,3)4)21(26)17-8-6-5-7-16(17)20(18)25/h5-8,11-12H,9-10H2,1-4H3 |
| InChIKey | DVITXSSNOCMCBF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|