About (3-oxocyclohexen-1-yl) nonanoate
(3-oxocyclohexen-1-yl) nonanoate (PubChem CID 91181212) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is (3-oxocyclohexen-1-yl) nonanoate.
Molecular Properties
| Compound Name | (3-oxocyclohexen-1-yl) nonanoate |
| PubChem CID | 91181212 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (3-oxocyclohexen-1-yl) nonanoate |
| SMILES | CCCCCCCCC(=O)OC1=CC(=O)CCC1 |
| InChI | InChI=1S/C15H24O3/c1-2-3-4-5-6-7-11-15(17)18-14-10-8-9-13(16)12-14/h12H,2-11H2,1H3 |
| InChIKey | VTZSFWCTSRVSPG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3-oxocyclohexen-1-yl) nonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxocyclohexen-1-yl) nonanoate?
The IUPAC name of (3-oxocyclohexen-1-yl) nonanoate (CID 91181212) is (3-oxocyclohexen-1-yl) nonanoate.
What is the SMILES notation for (3-oxocyclohexen-1-yl) nonanoate?
The canonical SMILES for (3-oxocyclohexen-1-yl) nonanoate is CCCCCCCCC(=O)OC1=CC(=O)CCC1.
What is the InChIKey of (3-oxocyclohexen-1-yl) nonanoate?
The InChIKey is VTZSFWCTSRVSPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3/c1-2-3-4-5-6-7-11-15(17)18-14-10-8-9-13(16)12-14/h12H,2-11H2,1H3.
What are the key properties of (3-oxocyclohexen-1-yl) nonanoate?
(3-oxocyclohexen-1-yl) nonanoate has a molecular weight of 252.35 g/mol, XLogP of 3.92, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxocyclohexen-1-yl) nonanoate is sourced from PubChem (CID 91181212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).