C10H11N3S — CID 59152191
N-(6-ethyl-2-pyridinyl)-1,3-thiazol-2-amine (PubChem CID 59152191) has the molecular formula C10H11N3S and a molecular weight of 205.29 g/mol. Its IUPAC name is N-(6-ethyl-2-pyridinyl)-1,3-thiazol-2-amine.
| Compound Name | N-(6-ethyl-2-pyridinyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 59152191 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | N-(6-ethyl-2-pyridinyl)-1,3-thiazol-2-amine |
| SMILES | CCc1cccc(Nc2nccs2)n1 |
| InChI | InChI=1S/C10H11N3S/c1-2-8-4-3-5-9(12-8)13-10-11-6-7-14-10/h3-7H,2H2,1H3,(H,11,12,13) |
| InChIKey | KLQPYJLHPYDCRE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |