C11H12FN3O3 — CID 59154844
4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]benzoic acid (PubChem CID 59154844) has the molecular formula C11H12FN3O3 and a molecular weight of 253.23 g/mol. Its IUPAC name is 4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]benzoic acid.
| Compound Name | 4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]benzoic acid |
|---|---|
| PubChem CID | 59154844 |
| Molecular Formula | C11H12FN3O3 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]benzoic acid |
| SMILES | CO[C@H](c1ccc(C(=O)O)cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C11H12FN3O3/c1-18-10(9(6-12)14-15-13)7-2-4-8(5-3-7)11(16)17/h2-5,9-10H,6H2,1H3,(H,16,17)/t9-,10-/m1/s1 |
| InChIKey | JOIPKDCEXNYPDY-NXEZZACHSA-N |
| XLogP | 2.72 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|