C35H47N7O6 — CID 59156395
benzyl N-[3-[[5-(butylamino)-3-[4-(phenylmethoxycarbonylamino)butanoyl]-6-(propylcarbamoyl)pyrazin-2-yl]amino]propyl]carbamate (PubChem CID 59156395) has the molecular formula C35H47N7O6 and a molecular weight of 661.80 g/mol. Its IUPAC name is benzyl N-[3-[[5-(butylamino)-3-[4-(phenylmethoxycarbonylamino)butanoyl]-6-(propylcarbamoyl)pyrazin-2-yl]amino]propyl]carbamate.
| Compound Name | benzyl N-[3-[[5-(butylamino)-3-[4-(phenylmethoxycarbonylamino)butanoyl]-6-(propylcarbamoyl)pyrazin-2-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 59156395 |
| Molecular Formula | C35H47N7O6 |
| Molecular Weight | 661.80 g/mol |
| Exact Mass | 661.36 |
| IUPAC Name | benzyl N-[3-[[5-(butylamino)-3-[4-(phenylmethoxycarbonylamino)butanoyl]-6-(propylcarbamoyl)pyrazin-2-yl]amino]propyl]carbamate |
| SMILES | CCCCNc1nc(C(=O)CCCNC(=O)OCc2ccccc2)c(NCCCNC(=O)OCc2ccccc2)nc1C(=O)NCCC |
| InChI | InChI=1S/C35H47N7O6/c1-3-5-20-36-32-30(33(44)38-19-4-2)42-31(37-22-13-23-40-35(46)48-25-27-16-10-7-11-17-27)29(41-32)28(43)18-12-21-39-34(45)47-24-26-14-8-6-9-15-26/h6-11,14-17H,3-5,12-13,18-25H2,1-2H3,(H,36,41)(H,37,42)(H,38,44)(H,39,45)(H,40,46) |
| InChIKey | LGZGPHPRDCQJDC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 172.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.80 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|