C12H9F2N3O2 — CID 59156543
4-[(2,6-difluorobenzoyl)amino]-2H-pyrrole-5-carboxamide (PubChem CID 59156543) has the molecular formula C12H9F2N3O2 and a molecular weight of 265.22 g/mol. Its IUPAC name is 4-[(2,6-difluorobenzoyl)amino]-2H-pyrrole-5-carboxamide.
| Compound Name | 4-[(2,6-difluorobenzoyl)amino]-2H-pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 59156543 |
| Molecular Formula | C12H9F2N3O2 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 4-[(2,6-difluorobenzoyl)amino]-2H-pyrrole-5-carboxamide |
| SMILES | NC(=O)C1=NCC=C1NC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C12H9F2N3O2/c13-6-2-1-3-7(14)9(6)12(19)17-8-4-5-16-10(8)11(15)18/h1-4H,5H2,(H2,15,18)(H,17,19) |
| InChIKey | SENSHAOMGOLGEI-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |