C34H44FN3O3S — CID 59158088
N-(1-adamantylmethyl)-3-[2-(4-fluorophenyl)ethylamino]-N-[5-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)pentyl]propanamide (PubChem CID 59158088) has the molecular formula C34H44FN3O3S and a molecular weight of 593.81 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-3-[2-(4-fluorophenyl)ethylamino]-N-[5-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)pentyl]propanamide.
| Compound Name | N-(1-adamantylmethyl)-3-[2-(4-fluorophenyl)ethylamino]-N-[5-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)pentyl]propanamide |
|---|---|
| PubChem CID | 59158088 |
| Molecular Formula | C34H44FN3O3S |
| Molecular Weight | 593.81 g/mol |
| Exact Mass | 593.31 |
| IUPAC Name | N-(1-adamantylmethyl)-3-[2-(4-fluorophenyl)ethylamino]-N-[5-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)pentyl]propanamide |
| SMILES | O=C(CCNCCc1ccc(F)cc1)N(CCCCCc1ccc(O)c2[nH]c(=O)sc12)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C34H44FN3O3S/c35-28-8-5-23(6-9-28)11-13-36-14-12-30(40)38(22-34-19-24-16-25(20-34)18-26(17-24)21-34)15-3-1-2-4-27-7-10-29(39)31-32(27)42-33(41)37-31/h5-10,24-26,36,39H,1-4,11-22H2,(H,37,41) |
| InChIKey | JIBXYTARFAVKLV-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.81 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|