C16H19N — CID 59158252
5-benzyl-2,3-diethylpyridine (PubChem CID 59158252) has the molecular formula C16H19N and a molecular weight of 225.34 g/mol. Its IUPAC name is 5-benzyl-2,3-diethylpyridine.
| Compound Name | 5-benzyl-2,3-diethylpyridine |
|---|---|
| PubChem CID | 59158252 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 5-benzyl-2,3-diethylpyridine |
| SMILES | CCc1cc(Cc2ccccc2)cnc1CC |
| InChI | InChI=1S/C16H19N/c1-3-15-11-14(12-17-16(15)4-2)10-13-8-6-5-7-9-13/h5-9,11-12H,3-4,10H2,1-2H3 |
| InChIKey | NTGQJHMACIGATO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |