About 5-benzyl-2,3-diethylpyridine
5-benzyl-2,3-diethylpyridine (PubChem CID 59158252) has the molecular formula C16H19N
and a molecular weight of 225.34 g/mol. Its IUPAC name is 5-benzyl-2,3-diethylpyridine.
Molecular Properties
| Compound Name | 5-benzyl-2,3-diethylpyridine |
| PubChem CID | 59158252 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 5-benzyl-2,3-diethylpyridine |
| SMILES | CCc1cc(Cc2ccccc2)cnc1CC |
| InChI | InChI=1S/C16H19N/c1-3-15-11-14(12-17-16(15)4-2)10-13-8-6-5-7-9-13/h5-9,11-12H,3-4,10H2,1-2H3 |
| InChIKey | NTGQJHMACIGATO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-benzyl-2,3-diethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-2,3-diethylpyridine?
The IUPAC name of 5-benzyl-2,3-diethylpyridine (CID 59158252) is 5-benzyl-2,3-diethylpyridine.
What is the SMILES notation for 5-benzyl-2,3-diethylpyridine?
The canonical SMILES for 5-benzyl-2,3-diethylpyridine is CCc1cc(Cc2ccccc2)cnc1CC.
What is the InChIKey of 5-benzyl-2,3-diethylpyridine?
The InChIKey is NTGQJHMACIGATO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N/c1-3-15-11-14(12-17-16(15)4-2)10-13-8-6-5-7-9-13/h5-9,11-12H,3-4,10H2,1-2H3.
What are the key properties of 5-benzyl-2,3-diethylpyridine?
5-benzyl-2,3-diethylpyridine has a molecular weight of 225.34 g/mol, XLogP of 3.80, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-2,3-diethylpyridine is sourced from PubChem (CID 59158252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).