C11H14N4O — CID 59161460
4-piperidin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 59161460) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-piperidin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-piperidin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 59161460 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4-piperidin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | O=C1Cc2c(ncnc2N2CCCCC2)N1 |
| InChI | InChI=1S/C11H14N4O/c16-9-6-8-10(14-9)12-7-13-11(8)15-4-2-1-3-5-15/h7H,1-6H2,(H,12,13,14,16) |
| InChIKey | SRULYFUDCFVKSQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |