C10H18O2 — CID 59163894
(5S,6S)-5,6-diethyl-2-methyloxan-3-one (PubChem CID 59163894) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (5S,6S)-5,6-diethyl-2-methyloxan-3-one.
| Compound Name | (5S,6S)-5,6-diethyl-2-methyloxan-3-one |
|---|---|
| PubChem CID | 59163894 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (5S,6S)-5,6-diethyl-2-methyloxan-3-one |
| SMILES | CC[C@H]1CC(=O)C(C)O[C@H]1CC |
| InChI | InChI=1S/C10H18O2/c1-4-8-6-9(11)7(3)12-10(8)5-2/h7-8,10H,4-6H2,1-3H3/t7?,8-,10-/m0/s1 |
| InChIKey | XDFMQRZVNZACOD-CFGJQEBVSA-N |
| XLogP | 2.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |