C6H10O4 — CID 90657639
(2S,5R,6S)-5,6-dihydroxy-2-methyloxan-3-one (PubChem CID 90657639) has the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. Its IUPAC name is (2S,5R,6S)-5,6-dihydroxy-2-methyloxan-3-one.
| Compound Name | (2S,5R,6S)-5,6-dihydroxy-2-methyloxan-3-one |
|---|---|
| PubChem CID | 90657639 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | (2S,5R,6S)-5,6-dihydroxy-2-methyloxan-3-one |
| SMILES | C[C@@H]1O[C@H](O)[C@H](O)CC1=O |
| InChI | InChI=1S/C6H10O4/c1-3-4(7)2-5(8)6(9)10-3/h3,5-6,8-9H,2H2,1H3/t3-,5+,6-/m0/s1 |
| InChIKey | ATPYMFXOZQEWIG-LFRDXLMFSA-N |
| XLogP | -0.96 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |