About (5S,6R)-2,5-dihydroxy-6-(hydroxymethyl)oxan-3-one
(5S,6R)-2,5-dihydroxy-6-(hydroxymethyl)oxan-3-one (PubChem CID 71311760) has the molecular formula C6H10O5
and a molecular weight of 162.14 g/mol. Its IUPAC name is (5S,6R)-2,5-dihydroxy-6-(hydroxymethyl)oxan-3-one.
Molecular Properties
| Compound Name | (5S,6R)-2,5-dihydroxy-6-(hydroxymethyl)oxan-3-one |
| PubChem CID | 71311760 |
| Molecular Formula | C6H10O5 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | (5S,6R)-2,5-dihydroxy-6-(hydroxymethyl)oxan-3-one |
| SMILES | O=C1C[C@H](O)[C@@H](CO)OC1O |
| InChI | InChI=1S/C6H10O5/c7-2-5-3(8)1-4(9)6(10)11-5/h3,5-8,10H,1-2H2/t3-,5+,6?/m0/s1 |
| InChIKey | UHPMJDGOAZMIID-OPAZFOKUSA-N |
| XLogP | -1.98 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5S,6R)-2,5-dihydroxy-6-(hydroxymethyl)oxan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S,6R)-2,5-dihydroxy-6-(hydroxymethyl)oxan-3-one?
The IUPAC name of (5S,6R)-2,5-dihydroxy-6-(hydroxymethyl)oxan-3-one (CID 71311760) is (5S,6R)-2,5-dihydroxy-6-(hydroxymethyl)oxan-3-one.
What is the SMILES notation for (5S,6R)-2,5-dihydroxy-6-(hydroxymethyl)oxan-3-one?
The canonical SMILES for (5S,6R)-2,5-dihydroxy-6-(hydroxymethyl)oxan-3-one is O=C1C[C@H](O)[C@@H](CO)OC1O.
What is the InChIKey of (5S,6R)-2,5-dihydroxy-6-(hydroxymethyl)oxan-3-one?
The InChIKey is UHPMJDGOAZMIID-OPAZFOKUSA-N. The full InChI is InChI=1S/C6H10O5/c7-2-5-3(8)1-4(9)6(10)11-5/h3,5-8,10H,1-2H2/t3-,5+,6?/m0/s1.
What are the key properties of (5S,6R)-2,5-dihydroxy-6-(hydroxymethyl)oxan-3-one?
(5S,6R)-2,5-dihydroxy-6-(hydroxymethyl)oxan-3-one has a molecular weight of 162.14 g/mol, XLogP of -1.98, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,6R)-2,5-dihydroxy-6-(hydroxymethyl)oxan-3-one is sourced from PubChem (CID 71311760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).