C6H8O5 — CID 45083324
(5S,6R)-5-hydroxy-6-(hydroxymethyl)oxane-2,3-dione (PubChem CID 45083324) has the molecular formula C6H8O5 and a molecular weight of 160.12 g/mol. Its IUPAC name is (5S,6R)-5-hydroxy-6-(hydroxymethyl)oxane-2,3-dione.
| Compound Name | (5S,6R)-5-hydroxy-6-(hydroxymethyl)oxane-2,3-dione |
|---|---|
| PubChem CID | 45083324 |
| Molecular Formula | C6H8O5 |
| Molecular Weight | 160.12 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | (5S,6R)-5-hydroxy-6-(hydroxymethyl)oxane-2,3-dione |
| SMILES | O=C1C[C@H](O)[C@@H](CO)OC1=O |
| InChI | InChI=1S/C6H8O5/c7-2-5-3(8)1-4(9)6(10)11-5/h3,5,7-8H,1-2H2/t3-,5+/m0/s1 |
| InChIKey | UODAMGJXLNHVCA-WVZVXSGGSA-N |
| XLogP | -1.78 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.12 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|