C16H12N2O3 — CID 59164733
(2R,6S)-4-(1,2-benzoxazol-3-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 59164733) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is (2R,6S)-4-(1,2-benzoxazol-3-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (2R,6S)-4-(1,2-benzoxazol-3-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 59164733 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (2R,6S)-4-(1,2-benzoxazol-3-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2C3C=CC(C3)[C@@H]2C(=O)N1c1noc2ccccc12 |
| InChI | InChI=1S/C16H12N2O3/c19-15-12-8-5-6-9(7-8)13(12)16(20)18(15)14-10-3-1-2-4-11(10)21-17-14/h1-6,8-9,12-13H,7H2/t8?,9?,12-,13+ |
| InChIKey | SYNZXFACXATUHQ-FNSGDYKBSA-N |
| XLogP | 2.14 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|