C29H50FNSi — CID 59164906
cyclopentyl-[5-(4-fluorocyclohexyl)-8-methyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl]-dimethylsilane (PubChem CID 59164906) has the molecular formula C29H50FNSi and a molecular weight of 459.81 g/mol. Its IUPAC name is cyclopentyl-[5-(4-fluorocyclohexyl)-8-methyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl]-dimethylsilane.
| Compound Name | cyclopentyl-[5-(4-fluorocyclohexyl)-8-methyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl]-dimethylsilane |
|---|---|
| PubChem CID | 59164906 |
| Molecular Formula | C29H50FNSi |
| Molecular Weight | 459.81 g/mol |
| Exact Mass | 459.37 |
| IUPAC Name | cyclopentyl-[5-(4-fluorocyclohexyl)-8-methyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl]-dimethylsilane |
| SMILES | CC1CCC2C(C1)C1C(C3CCCCC3C1[Si](C)(C)C1CCCC1)N2C1CCC(F)CC1 |
| InChI | InChI=1S/C29H50FNSi/c1-19-12-17-26-25(18-19)27-28(31(26)21-15-13-20(30)14-16-21)23-10-6-7-11-24(23)29(27)32(2,3)22-8-4-5-9-22/h19-29H,4-18H2,1-3H3 |
| InChIKey | SOKXWERCCPTNQI-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.81 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|