C23H40FNSi — CID 59164904
cyclopentyl-(2-fluoro-5-methyl-2,3,4,4a,5a,6,6a,7,8,9,10,10a,10b,10c-tetradecahydro-1H-indeno[2,1-b]indol-6-yl)-dimethylsilane (PubChem CID 59164904) has the molecular formula C23H40FNSi and a molecular weight of 377.66 g/mol. Its IUPAC name is cyclopentyl-(2-fluoro-5-methyl-2,3,4,4a,5a,6,6a,7,8,9,10,10a,10b,10c-tetradecahydro-1H-indeno[2,1-b]indol-6-yl)-dimethylsilane.
| Compound Name | cyclopentyl-(2-fluoro-5-methyl-2,3,4,4a,5a,6,6a,7,8,9,10,10a,10b,10c-tetradecahydro-1H-indeno[2,1-b]indol-6-yl)-dimethylsilane |
|---|---|
| PubChem CID | 59164904 |
| Molecular Formula | C23H40FNSi |
| Molecular Weight | 377.66 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | cyclopentyl-(2-fluoro-5-methyl-2,3,4,4a,5a,6,6a,7,8,9,10,10a,10b,10c-tetradecahydro-1H-indeno[2,1-b]indol-6-yl)-dimethylsilane |
| SMILES | CN1C2CCC(F)CC2C2C3CCCCC3C([Si](C)(C)C3CCCC3)C21 |
| InChI | InChI=1S/C23H40FNSi/c1-25-20-13-12-15(24)14-19(20)21-17-10-6-7-11-18(17)23(22(21)25)26(2,3)16-8-4-5-9-16/h15-23H,4-14H2,1-3H3 |
| InChIKey | NABMSYAKVJEYDY-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.66 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|