C24H46Cl2N2SiTi-2 — CID 58582252
tert-butyl-[dimethyl-(5-methyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl)silyl]azanide;dichlorotitanium;ethane (PubChem CID 58582252) has the molecular formula C24H46Cl2N2SiTi-2 and a molecular weight of 509.51 g/mol. Its IUPAC name is tert-butyl-[dimethyl-(5-methyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl)silyl]azanide;dichlorotitanium;ethane.
| Compound Name | tert-butyl-[dimethyl-(5-methyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl)silyl]azanide;dichlorotitanium;ethane |
|---|---|
| PubChem CID | 58582252 |
| Molecular Formula | C24H46Cl2N2SiTi-2 |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | tert-butyl-[dimethyl-(5-methyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl)silyl]azanide;dichlorotitanium;ethane |
| SMILES | CN1C2CCCCC2C2C1C1CCCCC1C2[Si](C)(C)[N-]C(C)(C)C.Cl[Ti]Cl.[CH2-]C |
| InChI | InChI=1S/C22H41N2Si.C2H5.2ClH.Ti/c1-22(2,3)23-25(5,6)21-16-12-8-7-11-15(16)20-19(21)17-13-9-10-14-18(17)24(20)4;1-2;;;/h15-21H,7-14H2,1-6H3;1H2,2H3;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | HJODVKZEMLQSIF-UHFFFAOYSA-L |
| XLogP | 8.26 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|