C15H25O5P — CID 59167306
2-[4-(2,4-dimethylpentan-2-yl)phenoxy]ethyl dihydrogen phosphate (PubChem CID 59167306) has the molecular formula C15H25O5P and a molecular weight of 316.33 g/mol. Its IUPAC name is 2-[4-(2,4-dimethylpentan-2-yl)phenoxy]ethyl dihydrogen phosphate.
| Compound Name | 2-[4-(2,4-dimethylpentan-2-yl)phenoxy]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 59167306 |
| Molecular Formula | C15H25O5P |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-[4-(2,4-dimethylpentan-2-yl)phenoxy]ethyl dihydrogen phosphate |
| SMILES | CC(C)CC(C)(C)c1ccc(OCCOP(=O)(O)O)cc1 |
| InChI | InChI=1S/C15H25O5P/c1-12(2)11-15(3,4)13-5-7-14(8-6-13)19-9-10-20-21(16,17)18/h5-8,12H,9-11H2,1-4H3,(H2,16,17,18) |
| InChIKey | TZXPCJOGDZFVIL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|