About CID 59168559
CID 59168559 (PubChem CID 59168559) has the molecular formula C15H26OSi2
and a molecular weight of 278.54 g/mol.
Molecular Properties
| Compound Name | CID 59168559 |
| PubChem CID | 59168559 |
| Molecular Formula | C15H26OSi2 |
| Molecular Weight | 278.54 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | — |
| SMILES | C[Si](C)CCCCCOc1ccc([Si](C)C)cc1 |
| InChI | InChI=1S/C15H26OSi2/c1-17(2)13-7-5-6-12-16-14-8-10-15(11-9-14)18(3)4/h8-11H,5-7,12-13H2,1-4H3 |
| InChIKey | RQPGNUOMSCQTNA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59168559 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59168559?
The IUPAC name of CID 59168559 (CID 59168559) is not available.
What is the SMILES notation for CID 59168559?
The canonical SMILES for CID 59168559 is C[Si](C)CCCCCOc1ccc([Si](C)C)cc1.
What is the InChIKey of CID 59168559?
The InChIKey is RQPGNUOMSCQTNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26OSi2/c1-17(2)13-7-5-6-12-16-14-8-10-15(11-9-14)18(3)4/h8-11H,5-7,12-13H2,1-4H3.
What are the key properties of CID 59168559?
CID 59168559 has a molecular weight of 278.54 g/mol, XLogP of 3.95, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59168559 is sourced from PubChem (CID 59168559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).