C31H37N3O5S — CID 59168834
benzyl (2S)-4-(benzylamino)-2-[[benzyl(3,3-dimethoxypropyl)carbamothioyl]amino]-4-oxobutanoate (PubChem CID 59168834) has the molecular formula C31H37N3O5S and a molecular weight of 563.72 g/mol. Its IUPAC name is benzyl (2S)-4-(benzylamino)-2-[[benzyl(3,3-dimethoxypropyl)carbamothioyl]amino]-4-oxobutanoate.
| Compound Name | benzyl (2S)-4-(benzylamino)-2-[[benzyl(3,3-dimethoxypropyl)carbamothioyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 59168834 |
| Molecular Formula | C31H37N3O5S |
| Molecular Weight | 563.72 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | benzyl (2S)-4-(benzylamino)-2-[[benzyl(3,3-dimethoxypropyl)carbamothioyl]amino]-4-oxobutanoate |
| SMILES | COC(CCN(Cc1ccccc1)C(=S)N[C@@H](CC(=O)NCc1ccccc1)C(=O)OCc1ccccc1)OC |
| InChI | InChI=1S/C31H37N3O5S/c1-37-29(38-2)18-19-34(22-25-14-8-4-9-15-25)31(40)33-27(30(36)39-23-26-16-10-5-11-17-26)20-28(35)32-21-24-12-6-3-7-13-24/h3-17,27,29H,18-23H2,1-2H3,(H,32,35)(H,33,40)/t27-/m0/s1 |
| InChIKey | GPULTJRTPHZALZ-MHZLTWQESA-N |
| XLogP | 4.19 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.72 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|