C24H30FmN2O6S — CID 59168824
(3S)-3-[[benzyl(3,3-dimethoxypropyl)carbamothioyl]amino]-4-oxo-4-phenylmethoxybutanoic acid;fermium (PubChem CID 59168824) has the molecular formula C24H30FmN2O6S and a molecular weight of 731.58 g/mol. Its IUPAC name is (3S)-3-[[benzyl(3,3-dimethoxypropyl)carbamothioyl]amino]-4-oxo-4-phenylmethoxybutanoic acid;fermium.
| Compound Name | (3S)-3-[[benzyl(3,3-dimethoxypropyl)carbamothioyl]amino]-4-oxo-4-phenylmethoxybutanoic acid;fermium |
|---|---|
| PubChem CID | 59168824 |
| Molecular Formula | C24H30FmN2O6S |
| Molecular Weight | 731.58 g/mol |
| Exact Mass | 731.28 |
| IUPAC Name | (3S)-3-[[benzyl(3,3-dimethoxypropyl)carbamothioyl]amino]-4-oxo-4-phenylmethoxybutanoic acid;fermium |
| SMILES | COC(CCN(Cc1ccccc1)C(=S)N[C@@H](CC(=O)O)C(=O)OCc1ccccc1)OC.[Fm] |
| InChI | InChI=1S/C24H30N2O6S.Fm/c1-30-22(31-2)13-14-26(16-18-9-5-3-6-10-18)24(33)25-20(15-21(27)28)23(29)32-17-19-11-7-4-8-12-19;/h3-12,20,22H,13-17H2,1-2H3,(H,25,33)(H,27,28);/t20-;/m0./s1 |
| InChIKey | XFYLNKWQANHGAO-BDQAORGHSA-N |
| XLogP | 2.96 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.58 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|