C12H16BNO5 — CID 59366659
(3S)-3-[[hydroxy(methyl)boranyl]amino]-4-oxo-4-phenylmethoxybutanoic acid (PubChem CID 59366659) has the molecular formula C12H16BNO5 and a molecular weight of 265.07 g/mol. Its IUPAC name is (3S)-3-[[hydroxy(methyl)boranyl]amino]-4-oxo-4-phenylmethoxybutanoic acid.
| Compound Name | (3S)-3-[[hydroxy(methyl)boranyl]amino]-4-oxo-4-phenylmethoxybutanoic acid |
|---|---|
| PubChem CID | 59366659 |
| Molecular Formula | C12H16BNO5 |
| Molecular Weight | 265.07 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (3S)-3-[[hydroxy(methyl)boranyl]amino]-4-oxo-4-phenylmethoxybutanoic acid |
| SMILES | CB(O)N[C@@H](CC(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C12H16BNO5/c1-13(18)14-10(7-11(15)16)12(17)19-8-9-5-3-2-4-6-9/h2-6,10,14,18H,7-8H2,1H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | NIRKHMNDOJHAQU-JTQLQIEISA-N |
| XLogP | 0.27 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.07 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|