C8H14FNO5 — CID 59170330
2-[[2-fluoro-2-[(2-methylpropan-2-yl)oxy]acetyl]amino]oxyacetic acid (PubChem CID 59170330) has the molecular formula C8H14FNO5 and a molecular weight of 223.20 g/mol. Its IUPAC name is 2-[[2-fluoro-2-[(2-methylpropan-2-yl)oxy]acetyl]amino]oxyacetic acid.
| Compound Name | 2-[[2-fluoro-2-[(2-methylpropan-2-yl)oxy]acetyl]amino]oxyacetic acid |
|---|---|
| PubChem CID | 59170330 |
| Molecular Formula | C8H14FNO5 |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 2-[[2-fluoro-2-[(2-methylpropan-2-yl)oxy]acetyl]amino]oxyacetic acid |
| SMILES | CC(C)(C)OC(F)C(=O)NOCC(=O)O |
| InChI | InChI=1S/C8H14FNO5/c1-8(2,3)15-6(9)7(13)10-14-4-5(11)12/h6H,4H2,1-3H3,(H,10,13)(H,11,12) |
| InChIKey | UNSKBLBPZQXLPH-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|