2-[[(2R)-2-aminobutanoyl]amino]oxyacetic acid

C6H12N2O4 — CID 104867444

IUPAC2-[[(2R)-2-aminobutanoyl]amino]oxyacetic acid
SMILESCC[C@@H](N)C(=O)NOCC(=O)O
InChIInChI=1S/C6H12N2O4/c1-2-4(7)6(11)8-12-3-5(9)10/h4H,2-3,7H2,1H3,(H,8,11)(H,9,10)/t4-/m1/s1
InChIKeyAXFMAGOOYZSUQH-SCSAIBSYSA-N
MW176.17 g/mol
LogP-1.14
Rot. Bonds5

About 2-[[(2R)-2-aminobutanoyl]amino]oxyacetic acid

2-[[(2R)-2-aminobutanoyl]amino]oxyacetic acid (PubChem CID 104867444) has the molecular formula C6H12N2O4 and a molecular weight of 176.17 g/mol. Its IUPAC name is 2-[[(2R)-2-aminobutanoyl]amino]oxyacetic acid.

Molecular Properties

Compound Name2-[[(2R)-2-aminobutanoyl]amino]oxyacetic acid
PubChem CID104867444
Molecular FormulaC6H12N2O4
Molecular Weight176.17 g/mol
Exact Mass176.08
IUPAC Name2-[[(2R)-2-aminobutanoyl]amino]oxyacetic acid
SMILESCC[C@@H](N)C(=O)NOCC(=O)O
InChIInChI=1S/C6H12N2O4/c1-2-4(7)6(11)8-12-3-5(9)10/h4H,2-3,7H2,1H3,(H,8,11)(H,9,10)/t4-/m1/s1
InChIKeyAXFMAGOOYZSUQH-SCSAIBSYSA-N
XLogP-1.14
TPSA101.65 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.17
LogP ≤ 5-1.14
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-[[(2R)-2-aminobutanoyl]amino]oxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[[(2S)-2-aminopentanoyl]amino]oxyacetic acid
CID 107570675
2-(2-methylpropanoylamino)oxyacetic acid
CID 60668072
2-[(2,2-difluoroacetyl)amino]oxyacetic acid
CID 103513309
3-amino-4-(ethoxyamino)-4-oxobutanoic acid
CID 64974788
(2R)-2-amino-N-methylbutanamide
CID 14888796
2-(ethoxycarbonylamino)oxyacetic acid
CID 60661243
3-(2-aminobutanoylamino)butanoic acid
CID 61159852
2-[[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]amino]oxyacetic acid
CID 103309195
2-[[2-fluoro-2-[(2-methylpropan-2-yl)oxy]acetyl]amino]oxyacetic acid
CID 59170330
2-amino-N-(1,3-dihydroxypropan-2-yl)butanamide
CID 65314270
2-amino-N-methylsulfonylbutanamide
CID 103287489
2-(ethylcarbamoylamino)oxyacetic acid
CID 53397416

Frequently Asked Questions

What is the IUPAC name of 2-[[(2R)-2-aminobutanoyl]amino]oxyacetic acid?
The IUPAC name of 2-[[(2R)-2-aminobutanoyl]amino]oxyacetic acid (CID 104867444) is 2-[[(2R)-2-aminobutanoyl]amino]oxyacetic acid.
What is the SMILES notation for 2-[[(2R)-2-aminobutanoyl]amino]oxyacetic acid?
The canonical SMILES for 2-[[(2R)-2-aminobutanoyl]amino]oxyacetic acid is CC[C@@H](N)C(=O)NOCC(=O)O.
What is the InChIKey of 2-[[(2R)-2-aminobutanoyl]amino]oxyacetic acid?
The InChIKey is AXFMAGOOYZSUQH-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H12N2O4/c1-2-4(7)6(11)8-12-3-5(9)10/h4H,2-3,7H2,1H3,(H,8,11)(H,9,10)/t4-/m1/s1.
What are the key properties of 2-[[(2R)-2-aminobutanoyl]amino]oxyacetic acid?
2-[[(2R)-2-aminobutanoyl]amino]oxyacetic acid has a molecular weight of 176.17 g/mol, XLogP of -1.14, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2R)-2-aminobutanoyl]amino]oxyacetic acid is sourced from PubChem (CID 104867444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).